2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride

C10H19ClO4S — CID 64999459

IUPAC2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride
SMILESCC(C)(COCC1CCCO1)CS(=O)(=O)Cl
InChIInChI=1S/C10H19ClO4S/c1-10(2,8-16(11,12)13)7-14-6-9-4-3-5-15-9/h9H,3-8H2,1-2H3
InChIKeyUCIYJWBHXBERKO-UHFFFAOYSA-N
MW270.78 g/mol
LogP1.78
Rot. Bonds6

About 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride

2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride (PubChem CID 64999459) has the molecular formula C10H19ClO4S and a molecular weight of 270.78 g/mol. Its IUPAC name is 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride.

Molecular Properties

Compound Name2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride
PubChem CID64999459
Molecular FormulaC10H19ClO4S
Molecular Weight270.78 g/mol
Exact Mass270.07
IUPAC Name2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride
SMILESCC(C)(COCC1CCCO1)CS(=O)(=O)Cl
InChIInChI=1S/C10H19ClO4S/c1-10(2,8-16(11,12)13)7-14-6-9-4-3-5-15-9/h9H,3-8H2,1-2H3
InChIKeyUCIYJWBHXBERKO-UHFFFAOYSA-N
XLogP1.78
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.78
LogP ≤ 51.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride?
The IUPAC name of 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride (CID 64999459) is 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride.
What is the SMILES notation for 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride?
The canonical SMILES for 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride is CC(C)(COCC1CCCO1)CS(=O)(=O)Cl.
What is the InChIKey of 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride?
The InChIKey is UCIYJWBHXBERKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClO4S/c1-10(2,8-16(11,12)13)7-14-6-9-4-3-5-15-9/h9H,3-8H2,1-2H3.
What are the key properties of 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride?
2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride has a molecular weight of 270.78 g/mol, XLogP of 1.78, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(oxolan-2-ylmethoxy)propane-1-sulfonyl chloride is sourced from PubChem (CID 64999459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).