About 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine
4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine (PubChem CID 65000043) has the molecular formula C11H22BrNO
and a molecular weight of 264.21 g/mol. Its IUPAC name is 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine |
| PubChem CID | 65000043 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine |
| SMILES | CCC(CBr)CN1CC(C)OCC1C |
| InChI | InChI=1S/C11H22BrNO/c1-4-11(5-12)7-13-6-10(3)14-8-9(13)2/h9-11H,4-8H2,1-3H3 |
| InChIKey | QFUGHNQUSUHNJE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine?
The IUPAC name of 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine (CID 65000043) is 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine.
What is the SMILES notation for 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine?
The canonical SMILES for 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine is CCC(CBr)CN1CC(C)OCC1C.
What is the InChIKey of 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine?
The InChIKey is QFUGHNQUSUHNJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22BrNO/c1-4-11(5-12)7-13-6-10(3)14-8-9(13)2/h9-11H,4-8H2,1-3H3.
What are the key properties of 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine?
4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine has a molecular weight of 264.21 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(bromomethyl)butyl]-2,5-dimethylmorpholine is sourced from PubChem (CID 65000043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).