C14H28BrN — CID 65000192
N-(3-bromo-2,2-dimethylpropyl)-4-ethyl-N-methylcyclohexan-1-amine (PubChem CID 65000192) has the molecular formula C14H28BrN and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)-4-ethyl-N-methylcyclohexan-1-amine.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)-4-ethyl-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 65000192 |
| Molecular Formula | C14H28BrN |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)-4-ethyl-N-methylcyclohexan-1-amine |
| SMILES | CCC1CCC(N(C)CC(C)(C)CBr)CC1 |
| InChI | InChI=1S/C14H28BrN/c1-5-12-6-8-13(9-7-12)16(4)11-14(2,3)10-15/h12-13H,5-11H2,1-4H3 |
| InChIKey | DVLHVDXNNYWTQC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|