About 2-(bromomethyl)-N,N-dimethylbutan-1-amine
2-(bromomethyl)-N,N-dimethylbutan-1-amine (PubChem CID 65000783) has the molecular formula C7H16BrN
and a molecular weight of 194.12 g/mol. Its IUPAC name is 2-(bromomethyl)-N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 2-(bromomethyl)-N,N-dimethylbutan-1-amine |
| PubChem CID | 65000783 |
| Molecular Formula | C7H16BrN |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-(bromomethyl)-N,N-dimethylbutan-1-amine |
| SMILES | CCC(CBr)CN(C)C |
| InChI | InChI=1S/C7H16BrN/c1-4-7(5-8)6-9(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | ODIOKGUEOQHAOG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-N,N-dimethylbutan-1-amine?
The IUPAC name of 2-(bromomethyl)-N,N-dimethylbutan-1-amine (CID 65000783) is 2-(bromomethyl)-N,N-dimethylbutan-1-amine.
What is the SMILES notation for 2-(bromomethyl)-N,N-dimethylbutan-1-amine?
The canonical SMILES for 2-(bromomethyl)-N,N-dimethylbutan-1-amine is CCC(CBr)CN(C)C.
What is the InChIKey of 2-(bromomethyl)-N,N-dimethylbutan-1-amine?
The InChIKey is ODIOKGUEOQHAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16BrN/c1-4-7(5-8)6-9(2)3/h7H,4-6H2,1-3H3.
What are the key properties of 2-(bromomethyl)-N,N-dimethylbutan-1-amine?
2-(bromomethyl)-N,N-dimethylbutan-1-amine has a molecular weight of 194.12 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-N,N-dimethylbutan-1-amine is sourced from PubChem (CID 65000783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).