C22H29N5O2S2 — CID 6500207
2-[[5-[(2,5-dimethylphenoxy)methyl]-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide (PubChem CID 6500207) has the molecular formula C22H29N5O2S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is 2-[[5-[(2,5-dimethylphenoxy)methyl]-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-[[5-[(2,5-dimethylphenoxy)methyl]-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 6500207 |
| Molecular Formula | C22H29N5O2S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[[5-[(2,5-dimethylphenoxy)methyl]-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1ccc(C)c(OCc2nnc(SC(C)C(=O)Nc3nc(C)c(C)s3)n2C(C)C)c1 |
| InChI | InChI=1S/C22H29N5O2S2/c1-12(2)27-19(11-29-18-10-13(3)8-9-14(18)4)25-26-22(27)31-17(7)20(28)24-21-23-15(5)16(6)30-21/h8-10,12,17H,11H2,1-7H3,(H,23,24,28) |
| InChIKey | SQUIOMBPRZUPHR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |