C19H28ClN — CID 65003123
N-[[2-(2-chlorophenyl)spiro[3.4]octan-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 65003123) has the molecular formula C19H28ClN and a molecular weight of 305.89 g/mol. Its IUPAC name is N-[[2-(2-chlorophenyl)spiro[3.4]octan-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-(2-chlorophenyl)spiro[3.4]octan-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 65003123 |
| Molecular Formula | C19H28ClN |
| Molecular Weight | 305.89 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-[[2-(2-chlorophenyl)spiro[3.4]octan-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1(c2ccccc2Cl)CC2(CCCC2)C1 |
| InChI | InChI=1S/C19H28ClN/c1-17(2,3)21-14-19(15-8-4-5-9-16(15)20)12-18(13-19)10-6-7-11-18/h4-5,8-9,21H,6-7,10-14H2,1-3H3 |
| InChIKey | BCNBPEYPOPPZNZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.89 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |