C13H17NO — CID 6500386
2,3-dimethyl-4-pyrrolidin-1-ylbenzaldehyde (PubChem CID 6500386) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,3-dimethyl-4-pyrrolidin-1-ylbenzaldehyde.
| Compound Name | 2,3-dimethyl-4-pyrrolidin-1-ylbenzaldehyde |
|---|---|
| PubChem CID | 6500386 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2,3-dimethyl-4-pyrrolidin-1-ylbenzaldehyde |
| SMILES | Cc1c(C=O)ccc(N2CCCC2)c1C |
| InChI | InChI=1S/C13H17NO/c1-10-11(2)13(6-5-12(10)9-15)14-7-3-4-8-14/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | RVRPZWHGMAXUAB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|