About [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride
[4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride (PubChem CID 65004262) has the molecular formula C15H21ClO4S
and a molecular weight of 332.85 g/mol. Its IUPAC name is [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride |
| PubChem CID | 65004262 |
| Molecular Formula | C15H21ClO4S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride |
| SMILES | Cc1cccc(C)c1OCC1(CS(=O)(=O)Cl)CCOCC1 |
| InChI | InChI=1S/C15H21ClO4S/c1-12-4-3-5-13(2)14(12)20-10-15(11-21(16,17)18)6-8-19-9-7-15/h3-5H,6-11H2,1-2H3 |
| InChIKey | HQRFFXBKWDMHMT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
The IUPAC name of [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride (CID 65004262) is [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride.
What is the SMILES notation for [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
The canonical SMILES for [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride is Cc1cccc(C)c1OCC1(CS(=O)(=O)Cl)CCOCC1.
What is the InChIKey of [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
The InChIKey is HQRFFXBKWDMHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO4S/c1-12-4-3-5-13(2)14(12)20-10-15(11-21(16,17)18)6-8-19-9-7-15/h3-5H,6-11H2,1-2H3.
What are the key properties of [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
[4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride has a molecular weight of 332.85 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,6-dimethylphenoxy)methyl]oxan-4-yl]methanesulfonyl chloride is sourced from PubChem (CID 65004262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).