About [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride
[4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride (PubChem CID 65004571) has the molecular formula C13H15Cl3O4S
and a molecular weight of 373.69 g/mol. Its IUPAC name is [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride |
| PubChem CID | 65004571 |
| Molecular Formula | C13H15Cl3O4S |
| Molecular Weight | 373.69 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC1(COc2cccc(Cl)c2Cl)CCOCC1 |
| InChI | InChI=1S/C13H15Cl3O4S/c14-10-2-1-3-11(12(10)15)20-8-13(9-21(16,17)18)4-6-19-7-5-13/h1-3H,4-9H2 |
| InChIKey | SXARQOHGMAMFDU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
The IUPAC name of [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride (CID 65004571) is [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride.
What is the SMILES notation for [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
The canonical SMILES for [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride is O=S(=O)(Cl)CC1(COc2cccc(Cl)c2Cl)CCOCC1.
What is the InChIKey of [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
The InChIKey is SXARQOHGMAMFDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl3O4S/c14-10-2-1-3-11(12(10)15)20-8-13(9-21(16,17)18)4-6-19-7-5-13/h1-3H,4-9H2.
What are the key properties of [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride?
[4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride has a molecular weight of 373.69 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,3-dichlorophenoxy)methyl]oxan-4-yl]methanesulfonyl chloride is sourced from PubChem (CID 65004571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).