C20H28N4O6S — CID 650049
4-[2-[[5-[(4-ethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine;oxalic acid (PubChem CID 650049) has the molecular formula C20H28N4O6S and a molecular weight of 452.53 g/mol. Its IUPAC name is 4-[2-[[5-[(4-ethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine;oxalic acid.
| Compound Name | 4-[2-[[5-[(4-ethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine;oxalic acid |
|---|---|
| PubChem CID | 650049 |
| Molecular Formula | C20H28N4O6S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 4-[2-[[5-[(4-ethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]morpholine;oxalic acid |
| SMILES | CCc1ccc(OCc2nnc(SCCN3CCOCC3)n2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H26N4O2S.C2H2O4/c1-3-15-4-6-16(7-5-15)24-14-17-19-20-18(21(17)2)25-13-10-22-8-11-23-12-9-22;3-1(4)2(5)6/h4-7H,3,8-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XNYQBINPWIZGPX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|