C15H29BrN2O — CID 65004912
1-[1-[[4-(bromomethyl)oxan-4-yl]methyl]piperidin-4-yl]-N,N-dimethylmethanamine (PubChem CID 65004912) has the molecular formula C15H29BrN2O and a molecular weight of 333.31 g/mol. Its IUPAC name is 1-[1-[[4-(bromomethyl)oxan-4-yl]methyl]piperidin-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-[[4-(bromomethyl)oxan-4-yl]methyl]piperidin-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 65004912 |
| Molecular Formula | C15H29BrN2O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[1-[[4-(bromomethyl)oxan-4-yl]methyl]piperidin-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCN(CC2(CBr)CCOCC2)CC1 |
| InChI | InChI=1S/C15H29BrN2O/c1-17(2)11-14-3-7-18(8-4-14)13-15(12-16)5-9-19-10-6-15/h14H,3-13H2,1-2H3 |
| InChIKey | UWAXJUZDGRZCDW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|