C16H33BrN2 — CID 65005084
1-[1-[2-(bromomethyl)-2-propylpentyl]pyrrolidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 65005084) has the molecular formula C16H33BrN2 and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-[1-[2-(bromomethyl)-2-propylpentyl]pyrrolidin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-[2-(bromomethyl)-2-propylpentyl]pyrrolidin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 65005084 |
| Molecular Formula | C16H33BrN2 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[1-[2-(bromomethyl)-2-propylpentyl]pyrrolidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CCCC(CBr)(CCC)CN1CCCC1CN(C)C |
| InChI | InChI=1S/C16H33BrN2/c1-5-9-16(13-17,10-6-2)14-19-11-7-8-15(19)12-18(3)4/h15H,5-14H2,1-4H3 |
| InChIKey | FDNDFOGSBLFXIW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|