About 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide
2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide (PubChem CID 65005157) has the molecular formula C11H22F3NO3S
and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide.
Molecular Properties
| Compound Name | 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide |
| PubChem CID | 65005157 |
| Molecular Formula | C11H22F3NO3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide |
| SMILES | CCCC(CCC)(COCC(F)(F)F)CS(N)(=O)=O |
| InChI | InChI=1S/C11H22F3NO3S/c1-3-5-10(6-4-2,9-19(15,16)17)7-18-8-11(12,13)14/h3-9H2,1-2H3,(H2,15,16,17) |
| InChIKey | KULDTRWWRZGTHP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide?
The IUPAC name of 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide (CID 65005157) is 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide.
What is the SMILES notation for 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide?
The canonical SMILES for 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide is CCCC(CCC)(COCC(F)(F)F)CS(N)(=O)=O.
What is the InChIKey of 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide?
The InChIKey is KULDTRWWRZGTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3NO3S/c1-3-5-10(6-4-2,9-19(15,16)17)7-18-8-11(12,13)14/h3-9H2,1-2H3,(H2,15,16,17).
What are the key properties of 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide?
2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide has a molecular weight of 305.36 g/mol, XLogP of 2.44, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonamide is sourced from PubChem (CID 65005157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).