About 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid
1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid (PubChem CID 65005288) has the molecular formula C17H22Cl2O2
and a molecular weight of 329.27 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid |
| PubChem CID | 65005288 |
| Molecular Formula | C17H22Cl2O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid |
| SMILES | CCCC1(CCC)CC(C(=O)O)(c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C17H22Cl2O2/c1-3-8-16(9-4-2)10-17(11-16,15(20)21)14-12(18)6-5-7-13(14)19/h5-7H,3-4,8-11H2,1-2H3,(H,20,21) |
| InChIKey | GYBHDMYSKGYLFQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid?
The IUPAC name of 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid (CID 65005288) is 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid is CCCC1(CCC)CC(C(=O)O)(c2c(Cl)cccc2Cl)C1.
What is the InChIKey of 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid?
The InChIKey is GYBHDMYSKGYLFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2O2/c1-3-8-16(9-4-2)10-17(11-16,15(20)21)14-12(18)6-5-7-13(14)19/h5-7H,3-4,8-11H2,1-2H3,(H,20,21).
What are the key properties of 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid?
1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid has a molecular weight of 329.27 g/mol, XLogP of 5.70, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichlorophenyl)-3,3-dipropylcyclobutane-1-carboxylic acid is sourced from PubChem (CID 65005288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).