About 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one
3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one (PubChem CID 65006733) has the molecular formula C10H14BrNO2S
and a molecular weight of 292.20 g/mol. Its IUPAC name is 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one |
| PubChem CID | 65006733 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one |
| SMILES | O=c1sccn1CC1(CBr)CCOCC1 |
| InChI | InChI=1S/C10H14BrNO2S/c11-7-10(1-4-14-5-2-10)8-12-3-6-15-9(12)13/h3,6H,1-2,4-5,7-8H2 |
| InChIKey | MOCVQWUWMLEYIS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one?
The IUPAC name of 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one (CID 65006733) is 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one.
What is the SMILES notation for 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one?
The canonical SMILES for 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one is O=c1sccn1CC1(CBr)CCOCC1.
What is the InChIKey of 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one?
The InChIKey is MOCVQWUWMLEYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrNO2S/c11-7-10(1-4-14-5-2-10)8-12-3-6-15-9(12)13/h3,6H,1-2,4-5,7-8H2.
What are the key properties of 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one?
3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one has a molecular weight of 292.20 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3-thiazol-2-one is sourced from PubChem (CID 65006733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).