About 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine
4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine (PubChem CID 65007329) has the molecular formula C16H31BrN2
and a molecular weight of 331.34 g/mol. Its IUPAC name is 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine.
Molecular Properties
| Compound Name | 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine |
| PubChem CID | 65007329 |
| Molecular Formula | C16H31BrN2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine |
| SMILES | CN1CCN(CC2(CBr)CCCCCC2)CC1(C)C |
| InChI | InChI=1S/C16H31BrN2/c1-15(2)13-19(11-10-18(15)3)14-16(12-17)8-6-4-5-7-9-16/h4-14H2,1-3H3 |
| InChIKey | CRSDDEDZZGLEEP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine?
The IUPAC name of 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine (CID 65007329) is 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine.
What is the SMILES notation for 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine?
The canonical SMILES for 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine is CN1CCN(CC2(CBr)CCCCCC2)CC1(C)C.
What is the InChIKey of 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine?
The InChIKey is CRSDDEDZZGLEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31BrN2/c1-15(2)13-19(11-10-18(15)3)14-16(12-17)8-6-4-5-7-9-16/h4-14H2,1-3H3.
What are the key properties of 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine?
4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine has a molecular weight of 331.34 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(bromomethyl)cycloheptyl]methyl]-1,2,2-trimethylpiperazine is sourced from PubChem (CID 65007329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).