About cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate
cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate (PubChem CID 650077) has the molecular formula C19H18N2O4S
and a molecular weight of 370.43 g/mol. Its IUPAC name is cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate |
| PubChem CID | 650077 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate |
| SMILES | N#Cc1cc2cc3c(cc2nc1SCC(=O)OC1CCCCC1)OCO3 |
| InChI | InChI=1S/C19H18N2O4S/c20-9-13-6-12-7-16-17(24-11-23-16)8-15(12)21-19(13)26-10-18(22)25-14-4-2-1-3-5-14/h6-8,14H,1-5,10-11H2 |
| InChIKey | XABIAOHIJHWXCN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate?
The IUPAC name of cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate (CID 650077) is cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate.
What is the SMILES notation for cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate?
The canonical SMILES for cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate is N#Cc1cc2cc3c(cc2nc1SCC(=O)OC1CCCCC1)OCO3.
What is the InChIKey of cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate?
The InChIKey is XABIAOHIJHWXCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O4S/c20-9-13-6-12-7-16-17(24-11-23-16)8-15(12)21-19(13)26-10-18(22)25-14-4-2-1-3-5-14/h6-8,14H,1-5,10-11H2.
What are the key properties of cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate?
cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate has a molecular weight of 370.43 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-[(7-cyano-[1,3]dioxolo[4,5-g]quinolin-6-yl)sulfanyl]acetate is sourced from PubChem (CID 650077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).