C16H21Cl2N — CID 65008495
N-[[5-(2,6-dichlorophenyl)spiro[2.3]hexan-5-yl]methyl]propan-1-amine (PubChem CID 65008495) has the molecular formula C16H21Cl2N and a molecular weight of 298.26 g/mol. Its IUPAC name is N-[[5-(2,6-dichlorophenyl)spiro[2.3]hexan-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2,6-dichlorophenyl)spiro[2.3]hexan-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65008495 |
| Molecular Formula | C16H21Cl2N |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[[5-(2,6-dichlorophenyl)spiro[2.3]hexan-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1(c2c(Cl)cccc2Cl)CC2(CC2)C1 |
| InChI | InChI=1S/C16H21Cl2N/c1-2-8-19-11-16(9-15(10-16)6-7-15)14-12(17)4-3-5-13(14)18/h3-5,19H,2,6-11H2,1H3 |
| InChIKey | MHOFYMIUEGKKIA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|