C12H15N3O3S — CID 6501018
N-[5-(ethoxymethyl)-1,3,4-thiadiazol-2-yl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 6501018) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[5-(ethoxymethyl)-1,3,4-thiadiazol-2-yl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-[5-(ethoxymethyl)-1,3,4-thiadiazol-2-yl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 6501018 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[5-(ethoxymethyl)-1,3,4-thiadiazol-2-yl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCOCc1nnc(NC(=O)C2CC3C=CC2O3)s1 |
| InChI | InChI=1S/C12H15N3O3S/c1-2-17-6-10-14-15-12(19-10)13-11(16)8-5-7-3-4-9(8)18-7/h3-4,7-9H,2,5-6H2,1H3,(H,13,15,16) |
| InChIKey | WHHWZQUTRAUTAQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|