C16H31BrN2 — CID 65010272
N-[[1-(bromomethyl)cycloheptyl]methyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 65010272) has the molecular formula C16H31BrN2 and a molecular weight of 331.34 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cycloheptyl]methyl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 65010272 |
| Molecular Formula | C16H31BrN2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[[1-(bromomethyl)cycloheptyl]methyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | CN1CCC(N(C)CC2(CBr)CCCCCC2)CC1 |
| InChI | InChI=1S/C16H31BrN2/c1-18-11-7-15(8-12-18)19(2)14-16(13-17)9-5-3-4-6-10-16/h15H,3-14H2,1-2H3 |
| InChIKey | KJURACOZWMJPGS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|