C14H23BrN4 — CID 65010832
2-[4-[2-(bromomethyl)pentyl]piperazin-1-yl]pyrimidine (PubChem CID 65010832) has the molecular formula C14H23BrN4 and a molecular weight of 327.27 g/mol. Its IUPAC name is 2-[4-[2-(bromomethyl)pentyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[2-(bromomethyl)pentyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 65010832 |
| Molecular Formula | C14H23BrN4 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[4-[2-(bromomethyl)pentyl]piperazin-1-yl]pyrimidine |
| SMILES | CCCC(CBr)CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H23BrN4/c1-2-4-13(11-15)12-18-7-9-19(10-8-18)14-16-5-3-6-17-14/h3,5-6,13H,2,4,7-12H2,1H3 |
| InChIKey | NKVLSZIKRVAVOH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|