About N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline
N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline (PubChem CID 65011630) has the molecular formula C15H24BrN
and a molecular weight of 298.27 g/mol. Its IUPAC name is N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline.
Molecular Properties
| Compound Name | N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline |
| PubChem CID | 65011630 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline |
| SMILES | Cc1cc(C)cc(N(C)CC(CBr)C(C)C)c1 |
| InChI | InChI=1S/C15H24BrN/c1-11(2)14(9-16)10-17(5)15-7-12(3)6-13(4)8-15/h6-8,11,14H,9-10H2,1-5H3 |
| InChIKey | YWGUSSOJFGXZEH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline?
The IUPAC name of N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline (CID 65011630) is N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline.
What is the SMILES notation for N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline?
The canonical SMILES for N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline is Cc1cc(C)cc(N(C)CC(CBr)C(C)C)c1.
What is the InChIKey of N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline?
The InChIKey is YWGUSSOJFGXZEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24BrN/c1-11(2)14(9-16)10-17(5)15-7-12(3)6-13(4)8-15/h6-8,11,14H,9-10H2,1-5H3.
What are the key properties of N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline?
N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline has a molecular weight of 298.27 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(bromomethyl)-3-methylbutyl]-N,3,5-trimethylaniline is sourced from PubChem (CID 65011630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).