C9H16BrN3OS — CID 65012355
3-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 65012355) has the molecular formula C9H16BrN3OS and a molecular weight of 294.22 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 65012355 |
| Molecular Formula | C9H16BrN3OS |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)C(CBr)CSc1n[nH]c(=O)n1C |
| InChI | InChI=1S/C9H16BrN3OS/c1-6(2)7(4-10)5-15-9-12-11-8(14)13(9)3/h6-7H,4-5H2,1-3H3,(H,11,14) |
| InChIKey | ZKCHAXPYAPRAAC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|