About 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride
2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride (PubChem CID 65012600) has the molecular formula C8H14ClF3O3S
and a molecular weight of 282.71 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride |
| PubChem CID | 65012600 |
| Molecular Formula | C8H14ClF3O3S |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride |
| SMILES | CCCC(COCC(F)(F)F)CS(=O)(=O)Cl |
| InChI | InChI=1S/C8H14ClF3O3S/c1-2-3-7(5-16(9,13)14)4-15-6-8(10,11)12/h7H,2-6H2,1H3 |
| InChIKey | WQHKXVRUFOMYJV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride?
The IUPAC name of 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride (CID 65012600) is 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride.
What is the SMILES notation for 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride?
The canonical SMILES for 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride is CCCC(COCC(F)(F)F)CS(=O)(=O)Cl.
What is the InChIKey of 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride?
The InChIKey is WQHKXVRUFOMYJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClF3O3S/c1-2-3-7(5-16(9,13)14)4-15-6-8(10,11)12/h7H,2-6H2,1H3.
What are the key properties of 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride?
2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride has a molecular weight of 282.71 g/mol, XLogP of 2.55, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,2-trifluoroethoxymethyl)pentane-1-sulfonyl chloride is sourced from PubChem (CID 65012600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).