C11H19BrN4 — CID 65013050
7-[2-(bromomethyl)pentyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 65013050) has the molecular formula C11H19BrN4 and a molecular weight of 287.20 g/mol. Its IUPAC name is 7-[2-(bromomethyl)pentyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 7-[2-(bromomethyl)pentyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 65013050 |
| Molecular Formula | C11H19BrN4 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 7-[2-(bromomethyl)pentyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCCC(CBr)CN1CCn2cnnc2C1 |
| InChI | InChI=1S/C11H19BrN4/c1-2-3-10(6-12)7-15-4-5-16-9-13-14-11(16)8-15/h9-10H,2-8H2,1H3 |
| InChIKey | QXTZOZXOZYZBQC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|