C15H19FO4S — CID 65014374
3-tert-butyl-1-(2-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid (PubChem CID 65014374) has the molecular formula C15H19FO4S and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-tert-butyl-1-(2-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid.
| Compound Name | 3-tert-butyl-1-(2-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 65014374 |
| Molecular Formula | C15H19FO4S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-tert-butyl-1-(2-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid |
| SMILES | CC(C)(C)C1CC(C(=O)O)(S(=O)(=O)c2ccccc2F)C1 |
| InChI | InChI=1S/C15H19FO4S/c1-14(2,3)10-8-15(9-10,13(17)18)21(19,20)12-7-5-4-6-11(12)16/h4-7,10H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | AHOFKYCVLGAWDH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |