C17H22BrNO2 — CID 65014400
1-[2-(bromomethyl)-3,3-dimethylbutyl]-5,7-dimethylindole-2,3-dione (PubChem CID 65014400) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]-5,7-dimethylindole-2,3-dione.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-5,7-dimethylindole-2,3-dione |
|---|---|
| PubChem CID | 65014400 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-5,7-dimethylindole-2,3-dione |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=O)N2CC(CBr)C(C)(C)C |
| InChI | InChI=1S/C17H22BrNO2/c1-10-6-11(2)14-13(7-10)15(20)16(21)19(14)9-12(8-18)17(3,4)5/h6-7,12H,8-9H2,1-5H3 |
| InChIKey | KYMPLDRDTPKXNZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|