C14H22BrNO2 — CID 65014656
3-[2-(bromomethyl)-3,3-dimethylbutyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 65014656) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-3,3-dimethylbutyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[2-(bromomethyl)-3,3-dimethylbutyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 65014656 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-[2-(bromomethyl)-3,3-dimethylbutyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC(C)(C)C(CBr)CN1C(=O)C2C(C1=O)C2(C)C |
| InChI | InChI=1S/C14H22BrNO2/c1-13(2,3)8(6-15)7-16-11(17)9-10(12(16)18)14(9,4)5/h8-10H,6-7H2,1-5H3 |
| InChIKey | OZRUIEXPYREQCI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|