C19H30BrN — CID 65014922
N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methylpropan-2-amine (PubChem CID 65014922) has the molecular formula C19H30BrN and a molecular weight of 352.36 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 65014922 |
| Molecular Formula | C19H30BrN |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[[1-(4-bromophenyl)-3-tert-butylcyclobutyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1(c2ccc(Br)cc2)CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C19H30BrN/c1-17(2,3)15-11-19(12-15,13-21-18(4,5)6)14-7-9-16(20)10-8-14/h7-10,15,21H,11-13H2,1-6H3 |
| InChIKey | DSBQONAUUVTLLF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |