About N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline
N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline (PubChem CID 65015307) has the molecular formula C15H24BrN
and a molecular weight of 298.27 g/mol. Its IUPAC name is N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline |
| PubChem CID | 65015307 |
| Molecular Formula | C15H24BrN |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)CC(CBr)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24BrN/c1-12-6-8-14(9-7-12)17(5)11-13(10-16)15(2,3)4/h6-9,13H,10-11H2,1-5H3 |
| InChIKey | RVUORHSUFWNALJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline?
The IUPAC name of N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline (CID 65015307) is N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline.
What is the SMILES notation for N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline?
The canonical SMILES for N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline is Cc1ccc(N(C)CC(CBr)C(C)(C)C)cc1.
What is the InChIKey of N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline?
The InChIKey is RVUORHSUFWNALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24BrN/c1-12-6-8-14(9-7-12)17(5)11-13(10-16)15(2,3)4/h6-9,13H,10-11H2,1-5H3.
What are the key properties of N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline?
N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline has a molecular weight of 298.27 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(bromomethyl)-3,3-dimethylbutyl]-N,4-dimethylaniline is sourced from PubChem (CID 65015307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).