About methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate
methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 6501551) has the molecular formula C20H25NO5
and a molecular weight of 359.42 g/mol. Its IUPAC name is methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate |
| PubChem CID | 6501551 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | CCN(Cc1ccccc1)C(=O)C1C(=O)CC(C)(C)C(C(=O)OC)C1=O |
| InChI | InChI=1S/C20H25NO5/c1-5-21(12-13-9-7-6-8-10-13)18(24)15-14(22)11-20(2,3)16(17(15)23)19(25)26-4/h6-10,15-16H,5,11-12H2,1-4H3 |
| InChIKey | FRVHIMILJVKLLT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate?
The IUPAC name of methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate (CID 6501551) is methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate.
What is the SMILES notation for methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate?
The canonical SMILES for methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate is CCN(Cc1ccccc1)C(=O)C1C(=O)CC(C)(C)C(C(=O)OC)C1=O.
What is the InChIKey of methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate?
The InChIKey is FRVHIMILJVKLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO5/c1-5-21(12-13-9-7-6-8-10-13)18(24)15-14(22)11-20(2,3)16(17(15)23)19(25)26-4/h6-10,15-16H,5,11-12H2,1-4H3.
What are the key properties of methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate?
methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate has a molecular weight of 359.42 g/mol, XLogP of 2.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[benzyl(ethyl)carbamoyl]-2,2-dimethyl-4,6-dioxocyclohexane-1-carboxylate is sourced from PubChem (CID 6501551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).