About 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol
1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 65015590) has the molecular formula C12H26BrNO2
and a molecular weight of 296.25 g/mol. Its IUPAC name is 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol |
| PubChem CID | 65015590 |
| Molecular Formula | C12H26BrNO2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)CC(CBr)C(C)(C)C |
| InChI | InChI=1S/C12H26BrNO2/c1-12(2,3)10(6-13)7-14(4)8-11(15)9-16-5/h10-11,15H,6-9H2,1-5H3 |
| InChIKey | FNUMUHXTPCATFB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol (CID 65015590) is 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol is COCC(O)CN(C)CC(CBr)C(C)(C)C.
What is the InChIKey of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol?
The InChIKey is FNUMUHXTPCATFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26BrNO2/c1-12(2,3)10(6-13)7-14(4)8-11(15)9-16-5/h10-11,15H,6-9H2,1-5H3.
What are the key properties of 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol?
1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol has a molecular weight of 296.25 g/mol, XLogP of 1.98, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(bromomethyl)-3,3-dimethylbutyl]-methylamino]-3-methoxypropan-2-ol is sourced from PubChem (CID 65015590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).