About 5-cyclooctyl-2,4-dimethylpyrazol-3-amine
5-cyclooctyl-2,4-dimethylpyrazol-3-amine (PubChem CID 65018283) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is 5-cyclooctyl-2,4-dimethylpyrazol-3-amine.
Molecular Properties
| Compound Name | 5-cyclooctyl-2,4-dimethylpyrazol-3-amine |
| PubChem CID | 65018283 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 5-cyclooctyl-2,4-dimethylpyrazol-3-amine |
| SMILES | Cc1c(C2CCCCCCC2)nn(C)c1N |
| InChI | InChI=1S/C13H23N3/c1-10-12(15-16(2)13(10)14)11-8-6-4-3-5-7-9-11/h11H,3-9,14H2,1-2H3 |
| InChIKey | JMYLKPZTKPRQER-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclooctyl-2,4-dimethylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclooctyl-2,4-dimethylpyrazol-3-amine?
The IUPAC name of 5-cyclooctyl-2,4-dimethylpyrazol-3-amine (CID 65018283) is 5-cyclooctyl-2,4-dimethylpyrazol-3-amine.
What is the SMILES notation for 5-cyclooctyl-2,4-dimethylpyrazol-3-amine?
The canonical SMILES for 5-cyclooctyl-2,4-dimethylpyrazol-3-amine is Cc1c(C2CCCCCCC2)nn(C)c1N.
What is the InChIKey of 5-cyclooctyl-2,4-dimethylpyrazol-3-amine?
The InChIKey is JMYLKPZTKPRQER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3/c1-10-12(15-16(2)13(10)14)11-8-6-4-3-5-7-9-11/h11H,3-9,14H2,1-2H3.
What are the key properties of 5-cyclooctyl-2,4-dimethylpyrazol-3-amine?
5-cyclooctyl-2,4-dimethylpyrazol-3-amine has a molecular weight of 221.35 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclooctyl-2,4-dimethylpyrazol-3-amine is sourced from PubChem (CID 65018283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).