C15H21Br2N — CID 65018447
cyclooctyl-(2,5-dibromophenyl)methanamine (PubChem CID 65018447) has the molecular formula C15H21Br2N and a molecular weight of 375.15 g/mol. Its IUPAC name is cyclooctyl-(2,5-dibromophenyl)methanamine.
| Compound Name | cyclooctyl-(2,5-dibromophenyl)methanamine |
|---|---|
| PubChem CID | 65018447 |
| Molecular Formula | C15H21Br2N |
| Molecular Weight | 375.15 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | cyclooctyl-(2,5-dibromophenyl)methanamine |
| SMILES | NC(c1cc(Br)ccc1Br)C1CCCCCCC1 |
| InChI | InChI=1S/C15H21Br2N/c16-12-8-9-14(17)13(10-12)15(18)11-6-4-2-1-3-5-7-11/h8-11,15H,1-7,18H2 |
| InChIKey | XGPNBSBPAJZCRT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.15 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |