C13H10N4O3 — CID 65019357
methyl 4-([1,2,4]triazolo[4,3-a]pyrazin-8-yloxy)benzoate (PubChem CID 65019357) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is methyl 4-([1,2,4]triazolo[4,3-a]pyrazin-8-yloxy)benzoate.
| Compound Name | methyl 4-([1,2,4]triazolo[4,3-a]pyrazin-8-yloxy)benzoate |
|---|---|
| PubChem CID | 65019357 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | methyl 4-([1,2,4]triazolo[4,3-a]pyrazin-8-yloxy)benzoate |
| SMILES | COC(=O)c1ccc(Oc2nccn3cnnc23)cc1 |
| InChI | InChI=1S/C13H10N4O3/c1-19-13(18)9-2-4-10(5-3-9)20-12-11-16-15-8-17(11)7-6-14-12/h2-8H,1H3 |
| InChIKey | HEGCLNKBFNJBHY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |