C16H16BrN3O2 — CID 6501967
5-[(5-bromo-2-ethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 6501967) has the molecular formula C16H16BrN3O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is 5-[(5-bromo-2-ethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(5-bromo-2-ethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 6501967 |
| Molecular Formula | C16H16BrN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 5-[(5-bromo-2-ethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCOc1ccc(Br)cc1CNc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H16BrN3O2/c1-2-22-15-6-3-11(17)7-10(15)9-18-12-4-5-13-14(8-12)20-16(21)19-13/h3-8,18H,2,9H2,1H3,(H2,19,20,21) |
| InChIKey | UHFPPKITRSEDQS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|