About [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane
[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane (PubChem CID 65020983) has the molecular formula C16H21BrF2O
and a molecular weight of 347.24 g/mol. Its IUPAC name is [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane.
Molecular Properties
| Compound Name | [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane |
| PubChem CID | 65020983 |
| Molecular Formula | C16H21BrF2O |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane |
| SMILES | COc1cc(F)c(C(Br)C2CCCCCCC2)c(F)c1 |
| InChI | InChI=1S/C16H21BrF2O/c1-20-12-9-13(18)15(14(19)10-12)16(17)11-7-5-3-2-4-6-8-11/h9-11,16H,2-8H2,1H3 |
| InChIKey | ZKSIFYBHHYSFBB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane?
The IUPAC name of [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane (CID 65020983) is [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane.
What is the SMILES notation for [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane?
The canonical SMILES for [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane is COc1cc(F)c(C(Br)C2CCCCCCC2)c(F)c1.
What is the InChIKey of [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane?
The InChIKey is ZKSIFYBHHYSFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrF2O/c1-20-12-9-13(18)15(14(19)10-12)16(17)11-7-5-3-2-4-6-8-11/h9-11,16H,2-8H2,1H3.
What are the key properties of [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane?
[bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane has a molecular weight of 347.24 g/mol, XLogP of 5.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [bromo-(2,6-difluoro-4-methoxyphenyl)methyl]cyclooctane is sourced from PubChem (CID 65020983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).