About 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol
4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol (PubChem CID 650218) has the molecular formula C21H17N3O3
and a molecular weight of 359.39 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol |
| PubChem CID | 650218 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol |
| SMILES | Oc1ccc(-c2nc3ccccn3c2NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H17N3O3/c25-16-7-5-15(6-8-16)20-21(24-10-2-1-3-19(24)23-20)22-12-14-4-9-17-18(11-14)27-13-26-17/h1-11,22,25H,12-13H2 |
| InChIKey | DVVPDZMOHQSTLB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol?
The IUPAC name of 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol (CID 650218) is 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol.
What is the SMILES notation for 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol?
The canonical SMILES for 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol is Oc1ccc(-c2nc3ccccn3c2NCc2ccc3c(c2)OCO3)cc1.
What is the InChIKey of 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol?
The InChIKey is DVVPDZMOHQSTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O3/c25-16-7-5-15(6-8-16)20-21(24-10-2-1-3-19(24)23-20)22-12-14-4-9-17-18(11-14)27-13-26-17/h1-11,22,25H,12-13H2.
What are the key properties of 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol?
4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol has a molecular weight of 359.39 g/mol, XLogP of 4.05, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,3-benzodioxol-5-ylmethylamino)imidazo[1,2-a]pyridin-2-yl]phenol is sourced from PubChem (CID 650218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).