About 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine
1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine (PubChem CID 65024773) has the molecular formula C10H17ClF3N
and a molecular weight of 243.70 g/mol. Its IUPAC name is 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine |
| PubChem CID | 65024773 |
| Molecular Formula | C10H17ClF3N |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)CCNC1(CCl)CCCCC1 |
| InChI | InChI=1S/C10H17ClF3N/c11-8-9(4-2-1-3-5-9)15-7-6-10(12,13)14/h15H,1-8H2 |
| InChIKey | JITYMFSQUFGZNR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
The IUPAC name of 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine (CID 65024773) is 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine.
What is the SMILES notation for 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
The canonical SMILES for 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine is FC(F)(F)CCNC1(CCl)CCCCC1.
What is the InChIKey of 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
The InChIKey is JITYMFSQUFGZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClF3N/c11-8-9(4-2-1-3-5-9)15-7-6-10(12,13)14/h15H,1-8H2.
What are the key properties of 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine?
1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine has a molecular weight of 243.70 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-N-(3,3,3-trifluoropropyl)cyclohexan-1-amine is sourced from PubChem (CID 65024773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).