C13H19ClN2 — CID 65024881
1-(chloromethyl)-N-(pyridin-2-ylmethyl)cyclohexan-1-amine (PubChem CID 65024881) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is 1-(chloromethyl)-N-(pyridin-2-ylmethyl)cyclohexan-1-amine.
| Compound Name | 1-(chloromethyl)-N-(pyridin-2-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 65024881 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1-(chloromethyl)-N-(pyridin-2-ylmethyl)cyclohexan-1-amine |
| SMILES | ClCC1(NCc2ccccn2)CCCCC1 |
| InChI | InChI=1S/C13H19ClN2/c14-11-13(7-3-1-4-8-13)16-10-12-6-2-5-9-15-12/h2,5-6,9,16H,1,3-4,7-8,10-11H2 |
| InChIKey | BZLZYVQBCSRUPP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|