C10H12Cl3N — CID 65025739
1-chloro-N-[(2,6-dichlorophenyl)methyl]propan-2-amine (PubChem CID 65025739) has the molecular formula C10H12Cl3N and a molecular weight of 252.57 g/mol. Its IUPAC name is 1-chloro-N-[(2,6-dichlorophenyl)methyl]propan-2-amine.
| Compound Name | 1-chloro-N-[(2,6-dichlorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 65025739 |
| Molecular Formula | C10H12Cl3N |
| Molecular Weight | 252.57 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 1-chloro-N-[(2,6-dichlorophenyl)methyl]propan-2-amine |
| SMILES | CC(CCl)NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H12Cl3N/c1-7(5-11)14-6-8-9(12)3-2-4-10(8)13/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | ZHYZTCYDIMVKBN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|