C16H24ClN — CID 65026217
1-(chloromethyl)-N-[(2,4,6-trimethylphenyl)methyl]cyclopentan-1-amine (PubChem CID 65026217) has the molecular formula C16H24ClN and a molecular weight of 265.83 g/mol. Its IUPAC name is 1-(chloromethyl)-N-[(2,4,6-trimethylphenyl)methyl]cyclopentan-1-amine.
| Compound Name | 1-(chloromethyl)-N-[(2,4,6-trimethylphenyl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 65026217 |
| Molecular Formula | C16H24ClN |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-(chloromethyl)-N-[(2,4,6-trimethylphenyl)methyl]cyclopentan-1-amine |
| SMILES | Cc1cc(C)c(CNC2(CCl)CCCC2)c(C)c1 |
| InChI | InChI=1S/C16H24ClN/c1-12-8-13(2)15(14(3)9-12)10-18-16(11-17)6-4-5-7-16/h8-9,18H,4-7,10-11H2,1-3H3 |
| InChIKey | JQRAWBAGCKCYKD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|