C15H13ClFNO3 — CID 65026525
2-(3-chloro-4-methoxyphenyl)-2-(3-fluoroanilino)acetic acid (PubChem CID 65026525) has the molecular formula C15H13ClFNO3 and a molecular weight of 309.72 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-2-(3-fluoroanilino)acetic acid.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-2-(3-fluoroanilino)acetic acid |
|---|---|
| PubChem CID | 65026525 |
| Molecular Formula | C15H13ClFNO3 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-2-(3-fluoroanilino)acetic acid |
| SMILES | COc1ccc(C(Nc2cccc(F)c2)C(=O)O)cc1Cl |
| InChI | InChI=1S/C15H13ClFNO3/c1-21-13-6-5-9(7-12(13)16)14(15(19)20)18-11-4-2-3-10(17)8-11/h2-8,14,18H,1H3,(H,19,20) |
| InChIKey | JRWJOYWBXPSUMR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |