C13H17ClN4 — CID 65027810
N-(4-chlorocyclohexyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine (PubChem CID 65027810) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is N-(4-chlorocyclohexyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine.
| Compound Name | N-(4-chlorocyclohexyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 65027810 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(4-chlorocyclohexyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
| SMILES | Cc1cc(NC2CCC(Cl)CC2)n2ncnc2c1 |
| InChI | InChI=1S/C13H17ClN4/c1-9-6-12-15-8-16-18(12)13(7-9)17-11-4-2-10(14)3-5-11/h6-8,10-11,17H,2-5H2,1H3 |
| InChIKey | GCZMWVXVWLAJAV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|