C9H14ClN3O2 — CID 65027955
3-[(2-chloro-3-methoxypropyl)amino]-1-methylpyrazin-2-one (PubChem CID 65027955) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 3-[(2-chloro-3-methoxypropyl)amino]-1-methylpyrazin-2-one.
| Compound Name | 3-[(2-chloro-3-methoxypropyl)amino]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 65027955 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-[(2-chloro-3-methoxypropyl)amino]-1-methylpyrazin-2-one |
| SMILES | COCC(Cl)CNc1nccn(C)c1=O |
| InChI | InChI=1S/C9H14ClN3O2/c1-13-4-3-11-8(9(13)14)12-5-7(10)6-15-2/h3-4,7H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | LKRSFAZZJOJWGQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|