C11H19ClN4O2 — CID 65028208
N-[3-(chloromethyl)pentan-3-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 65028208) has the molecular formula C11H19ClN4O2 and a molecular weight of 274.75 g/mol. Its IUPAC name is N-[3-(chloromethyl)pentan-3-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[3-(chloromethyl)pentan-3-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65028208 |
| Molecular Formula | C11H19ClN4O2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[3-(chloromethyl)pentan-3-yl]-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | CCC(CC)(CCl)Nc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C11H19ClN4O2/c1-5-11(6-2,7-12)16-8-13-9(17-3)15-10(14-8)18-4/h5-7H2,1-4H3,(H,13,14,15,16) |
| InChIKey | XWQKCWWZTIZDEH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|