C15H22ClNO2S — CID 65028605
N-[1-(chloromethyl)-3-methylcyclohexyl]-2-methylsulfonylaniline (PubChem CID 65028605) has the molecular formula C15H22ClNO2S and a molecular weight of 315.87 g/mol. Its IUPAC name is N-[1-(chloromethyl)-3-methylcyclohexyl]-2-methylsulfonylaniline.
| Compound Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-2-methylsulfonylaniline |
|---|---|
| PubChem CID | 65028605 |
| Molecular Formula | C15H22ClNO2S |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-2-methylsulfonylaniline |
| SMILES | CC1CCCC(CCl)(Nc2ccccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H22ClNO2S/c1-12-6-5-9-15(10-12,11-16)17-13-7-3-4-8-14(13)20(2,18)19/h3-4,7-8,12,17H,5-6,9-11H2,1-2H3 |
| InChIKey | AEANWOGXDLZSIT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|