C12H18ClN3O — CID 65028809
3-[(1-chloro-2-methylbutan-2-yl)amino]-1-cyclopropylpyrazin-2-one (PubChem CID 65028809) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 3-[(1-chloro-2-methylbutan-2-yl)amino]-1-cyclopropylpyrazin-2-one.
| Compound Name | 3-[(1-chloro-2-methylbutan-2-yl)amino]-1-cyclopropylpyrazin-2-one |
|---|---|
| PubChem CID | 65028809 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-[(1-chloro-2-methylbutan-2-yl)amino]-1-cyclopropylpyrazin-2-one |
| SMILES | CCC(C)(CCl)Nc1nccn(C2CC2)c1=O |
| InChI | InChI=1S/C12H18ClN3O/c1-3-12(2,8-13)15-10-11(17)16(7-6-14-10)9-4-5-9/h6-7,9H,3-5,8H2,1-2H3,(H,14,15) |
| InChIKey | NFVZBMHWYGAWPB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|