About N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine
N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine (PubChem CID 65029238) has the molecular formula C12H18ClN3
and a molecular weight of 239.75 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine.
Molecular Properties
| Compound Name | N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine |
| PubChem CID | 65029238 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine |
| SMILES | Cc1cnc(C)c(NC2CCCCC2Cl)n1 |
| InChI | InChI=1S/C12H18ClN3/c1-8-7-14-9(2)12(15-8)16-11-6-4-3-5-10(11)13/h7,10-11H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | RPIOOPKRAGRFAR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine?
The IUPAC name of N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine (CID 65029238) is N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine.
What is the SMILES notation for N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine?
The canonical SMILES for N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine is Cc1cnc(C)c(NC2CCCCC2Cl)n1.
What is the InChIKey of N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine?
The InChIKey is RPIOOPKRAGRFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3/c1-8-7-14-9(2)12(15-8)16-11-6-4-3-5-10(11)13/h7,10-11H,3-6H2,1-2H3,(H,15,16).
What are the key properties of N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine?
N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine has a molecular weight of 239.75 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorocyclohexyl)-3,6-dimethylpyrazin-2-amine is sourced from PubChem (CID 65029238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).