C23H26N4O6S — CID 650305
N'-(furan-2-ylmethyl)-N'-[1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 650305) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N'-[1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N'-(furan-2-ylmethyl)-N'-[1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 650305 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N'-[1-(4-hydroxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | COCCNC(=O)C(c1ccc(O)cc1)N(Cc1ccco1)C(=O)CCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C23H26N4O6S/c1-32-13-10-24-22(31)21(16-4-6-17(28)7-5-16)27(15-18-3-2-12-33-18)20(30)9-8-19(29)26-23-25-11-14-34-23/h2-7,11-12,14,21,28H,8-10,13,15H2,1H3,(H,24,31)(H,25,26,29) |
| InChIKey | GRFAXDCQKPCNPI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|